C18H26FN5O2P2 — CID 170393924
3-[[4-(diethylamino)-6-[3-fluoro-2-methyl-2,3-bis(phosphanyl)propoxy]-1,3,5-triazin-2-yl]amino]benzaldehyde (PubChem CID 170393924) has the molecular formula C18H26FN5O2P2 and a molecular weight of 425.39 g/mol. Its IUPAC name is 3-[[4-(diethylamino)-6-[3-fluoro-2-methyl-2,3-bis(phosphanyl)propoxy]-1,3,5-triazin-2-yl]amino]benzaldehyde.
| Compound Name | 3-[[4-(diethylamino)-6-[3-fluoro-2-methyl-2,3-bis(phosphanyl)propoxy]-1,3,5-triazin-2-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 170393924 |
| Molecular Formula | C18H26FN5O2P2 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[[4-(diethylamino)-6-[3-fluoro-2-methyl-2,3-bis(phosphanyl)propoxy]-1,3,5-triazin-2-yl]amino]benzaldehyde |
| SMILES | CCN(CC)c1nc(Nc2cccc(C=O)c2)nc(OCC(C)(P)C(F)P)n1 |
| InChI | InChI=1S/C18H26FN5O2P2/c1-4-24(5-2)16-21-15(20-13-8-6-7-12(9-13)10-25)22-17(23-16)26-11-18(3,28)14(19)27/h6-10,14H,4-5,11,27-28H2,1-3H3,(H,20,21,22,23) |
| InChIKey | XFOSINRJDLMXKJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|