C16H19ClF3N5O — CID 158298723
4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine (PubChem CID 158298723) has the molecular formula C16H19ClF3N5O and a molecular weight of 389.81 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 158298723 |
| Molecular Formula | C16H19ClF3N5O |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Nc2cccc(Cl)c2)nc(OC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C16H19ClF3N5O/c1-4-25(5-2)14-22-13(21-12-8-6-7-11(17)9-12)23-15(24-14)26-10(3)16(18,19)20/h6-10H,4-5H2,1-3H3,(H,21,22,23,24) |
| InChIKey | VAHPLBYYUACPBA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |