C12H11ClF6N4O2 — CID 87601199
N-[[4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]oxy]cyclohexanimine (PubChem CID 87601199) has the molecular formula C12H11ClF6N4O2 and a molecular weight of 392.69 g/mol. Its IUPAC name is N-[[4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]oxy]cyclohexanimine.
| Compound Name | N-[[4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]oxy]cyclohexanimine |
|---|---|
| PubChem CID | 87601199 |
| Molecular Formula | C12H11ClF6N4O2 |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[[4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]oxy]cyclohexanimine |
| SMILES | FC(F)(F)C(Oc1nc(Cl)nc(ON=C2CCCCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF6N4O2/c13-8-20-9(24-7(11(14,15)16)12(17,18)19)22-10(21-8)25-23-6-4-2-1-3-5-6/h7H,1-5H2 |
| InChIKey | VFVKEXAVZDKRQW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|