C12H19ClN4O2 — CID 80879481
4-chloro-6-(oxan-4-ylmethoxy)-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80879481) has the molecular formula C12H19ClN4O2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 4-chloro-6-(oxan-4-ylmethoxy)-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(oxan-4-ylmethoxy)-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80879481 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-chloro-6-(oxan-4-ylmethoxy)-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(Cl)nc(OCC2CCOCC2)n1 |
| InChI | InChI=1S/C12H19ClN4O2/c1-2-5-14-11-15-10(13)16-12(17-11)19-8-9-3-6-18-7-4-9/h9H,2-8H2,1H3,(H,14,15,16,17) |
| InChIKey | HFILVJIPTVPQHO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |