C14H21N5O2 — CID 114787653
6-(oxan-4-ylmethoxy)-N-propyl-7H-purin-2-amine (PubChem CID 114787653) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-(oxan-4-ylmethoxy)-N-propyl-7H-purin-2-amine.
| Compound Name | 6-(oxan-4-ylmethoxy)-N-propyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114787653 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 6-(oxan-4-ylmethoxy)-N-propyl-7H-purin-2-amine |
| SMILES | CCCNc1nc(OCC2CCOCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H21N5O2/c1-2-5-15-14-18-12-11(16-9-17-12)13(19-14)21-8-10-3-6-20-7-4-10/h9-10H,2-8H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | OAXFDUNOHBHEBL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |