C15H24ClN5 — CID 101229509
6-chloro-2-N,4-N-bis(hex-5-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 101229509) has the molecular formula C15H24ClN5 and a molecular weight of 309.85 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(hex-5-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(hex-5-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 101229509 |
| Molecular Formula | C15H24ClN5 |
| Molecular Weight | 309.85 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(hex-5-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCCCCNc1nc(Cl)nc(NCCCCC=C)n1 |
| InChI | InChI=1S/C15H24ClN5/c1-3-5-7-9-11-17-14-19-13(16)20-15(21-14)18-12-10-8-6-4-2/h3-4H,1-2,5-12H2,(H2,17,18,19,20,21) |
| InChIKey | TXTKDTGJQMLZFR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|