C10H14BrN3O — CID 103853765
5-bromo-N-(2-but-3-enoxyethyl)pyrimidin-2-amine (PubChem CID 103853765) has the molecular formula C10H14BrN3O and a molecular weight of 272.15 g/mol. Its IUPAC name is 5-bromo-N-(2-but-3-enoxyethyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-N-(2-but-3-enoxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 103853765 |
| Molecular Formula | C10H14BrN3O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5-bromo-N-(2-but-3-enoxyethyl)pyrimidin-2-amine |
| SMILES | C=CCCOCCNc1ncc(Br)cn1 |
| InChI | InChI=1S/C10H14BrN3O/c1-2-3-5-15-6-4-12-10-13-7-9(11)8-14-10/h2,7-8H,1,3-6H2,(H,12,13,14) |
| InChIKey | HHIDJTWTGHHONC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|