C11H19Cl2N5O3 — CID 142808201
N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-4,6-dichloro-1,3,5-triazin-2-amine (PubChem CID 142808201) has the molecular formula C11H19Cl2N5O3 and a molecular weight of 340.21 g/mol. Its IUPAC name is N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-4,6-dichloro-1,3,5-triazin-2-amine.
| Compound Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-4,6-dichloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 142808201 |
| Molecular Formula | C11H19Cl2N5O3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-4,6-dichloro-1,3,5-triazin-2-amine |
| SMILES | NCCOCCOCCOCCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C11H19Cl2N5O3/c12-9-16-10(13)18-11(17-9)15-2-4-20-6-8-21-7-5-19-3-1-14/h1-8,14H2,(H,15,16,17,18) |
| InChIKey | FTTJEMIHGDJQQD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|