C22H33ClN6O2 — CID 23928724
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-chlorophenyl)methyl]-6-cyclohexyl-1,3,5-triazine-2,4-diamine (PubChem CID 23928724) has the molecular formula C22H33ClN6O2 and a molecular weight of 449.00 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-chlorophenyl)methyl]-6-cyclohexyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-chlorophenyl)methyl]-6-cyclohexyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23928724 |
| Molecular Formula | C22H33ClN6O2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-chlorophenyl)methyl]-6-cyclohexyl-1,3,5-triazine-2,4-diamine |
| SMILES | NCCOCCOCCNc1nc(NCc2ccc(Cl)cc2)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C22H33ClN6O2/c23-19-8-6-17(7-9-19)16-26-22-28-20(18-4-2-1-3-5-18)27-21(29-22)25-11-13-31-15-14-30-12-10-24/h6-9,18H,1-5,10-16,24H2,(H2,25,26,27,28,29) |
| InChIKey | XGKLNFCGWWDMBK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|