C21H34N8O2 — CID 23845134
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-cyclopentyl-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 23845134) has the molecular formula C21H34N8O2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-cyclopentyl-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-cyclopentyl-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23845134 |
| Molecular Formula | C21H34N8O2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-cyclopentyl-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCOCCOCCNc1nc(NCCc2ccccn2)nc(NC2CCCC2)n1 |
| InChI | InChI=1S/C21H34N8O2/c22-9-13-30-15-16-31-14-12-25-20-27-19(24-11-8-17-5-3-4-10-23-17)28-21(29-20)26-18-6-1-2-7-18/h3-5,10,18H,1-2,6-9,11-16,22H2,(H3,24,25,26,27,28,29) |
| InChIKey | RUKATBNDXZAUKG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|