C14H27N7O3 — CID 23816247
2-[[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 23816247) has the molecular formula C14H27N7O3 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 23816247 |
| Molecular Formula | C14H27N7O3 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2-[[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | NCCOCCOCCNc1nc(NCCO)nc(NC2CC2)n1 |
| InChI | InChI=1S/C14H27N7O3/c15-3-7-23-9-10-24-8-5-17-13-19-12(16-4-6-22)20-14(21-13)18-11-1-2-11/h11,22H,1-10,15H2,(H3,16,17,18,19,20,21) |
| InChIKey | NVSVGBKZYLXKPA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|