C22H34N6O3 — CID 23901103
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(4-methylcyclohexyl)-6-phenoxy-1,3,5-triazine-2,4-diamine (PubChem CID 23901103) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(4-methylcyclohexyl)-6-phenoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(4-methylcyclohexyl)-6-phenoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23901103 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(4-methylcyclohexyl)-6-phenoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CC1CCC(Nc2nc(NCCOCCOCCN)nc(Oc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C22H34N6O3/c1-17-7-9-18(10-8-17)25-21-26-20(24-12-14-30-16-15-29-13-11-23)27-22(28-21)31-19-5-3-2-4-6-19/h2-6,17-18H,7-16,23H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | VEXJMMLMYMSXQI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|