C28H41N7O2 — CID 23984657
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-4-N-(3,3-diphenylpropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 23984657) has the molecular formula C28H41N7O2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-4-N-(3,3-diphenylpropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-4-N-(3,3-diphenylpropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23984657 |
| Molecular Formula | C28H41N7O2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-4-N-(3,3-diphenylpropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(NCCOCCOCCN)nc(NCCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H41N7O2/c1-2-3-16-30-26-33-27(35-28(34-26)32-18-20-37-22-21-36-19-15-29)31-17-14-25(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-13,25H,2-3,14-22,29H2,1H3,(H3,30,31,32,33,34,35) |
| InChIKey | FOBXKZQGDGKWRJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|