C28H48N6O3 — CID 23984278
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-[2-(4-methoxyphenyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 23984278) has the molecular formula C28H48N6O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-[2-(4-methoxyphenyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-[2-(4-methoxyphenyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23984278 |
| Molecular Formula | C28H48N6O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-[2-(4-methoxyphenyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCCCc1nc(NCCOCCOCCN)nc(NCCc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C28H48N6O3/c1-3-4-5-6-7-8-9-10-11-26-32-27(30-18-16-24-12-14-25(35-2)15-13-24)34-28(33-26)31-19-21-37-23-22-36-20-17-29/h12-15H,3-11,16-23,29H2,1-2H3,(H2,30,31,32,33,34) |
| InChIKey | DHHJZONKKKZIQM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|