C25H46N8O2 — CID 23844781
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23844781) has the molecular formula C25H46N8O2 and a molecular weight of 490.70 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23844781 |
| Molecular Formula | C25H46N8O2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-decyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCCCc1nc(NCCCn2ccnc2)nc(NCCOCCOCCN)n1 |
| InChI | InChI=1S/C25H46N8O2/c1-2-3-4-5-6-7-8-9-11-23-30-24(28-13-10-16-33-17-14-27-22-33)32-25(31-23)29-15-19-35-21-20-34-18-12-26/h14,17,22H,2-13,15-16,18-21,26H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | RRPVXHJUPKLVLT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|