C21H29ClN8O2 — CID 23816109
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-(4-chlorophenyl)-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23816109) has the molecular formula C21H29ClN8O2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-(4-chlorophenyl)-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-(4-chlorophenyl)-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23816109 |
| Molecular Formula | C21H29ClN8O2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-(4-chlorophenyl)-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | NCCOCCOCCNc1nc(NCCCn2ccnc2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H29ClN8O2/c22-18-4-2-17(3-5-18)19-27-20(25-7-1-10-30-11-8-24-16-30)29-21(28-19)26-9-13-32-15-14-31-12-6-23/h2-5,8,11,16H,1,6-7,9-10,12-15,23H2,(H2,25,26,27,28,29) |
| InChIKey | FKAXVUZIRZSBNG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|