C20H18ClN5 — CID 68862663
7-chloro-N-(3-imidazol-1-ylpropyl)-2-phenylquinazolin-4-amine (PubChem CID 68862663) has the molecular formula C20H18ClN5 and a molecular weight of 363.85 g/mol. Its IUPAC name is 7-chloro-N-(3-imidazol-1-ylpropyl)-2-phenylquinazolin-4-amine.
| Compound Name | 7-chloro-N-(3-imidazol-1-ylpropyl)-2-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 68862663 |
| Molecular Formula | C20H18ClN5 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 7-chloro-N-(3-imidazol-1-ylpropyl)-2-phenylquinazolin-4-amine |
| SMILES | Clc1ccc2c(NCCCn3ccnc3)nc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C20H18ClN5/c21-16-7-8-17-18(13-16)24-19(15-5-2-1-3-6-15)25-20(17)23-9-4-11-26-12-10-22-14-26/h1-3,5-8,10,12-14H,4,9,11H2,(H,23,24,25) |
| InChIKey | NTPFDVFKSZYEPC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|