C24H18ClF3N4O — CID 42809231
N-[2-[(7-chloro-2-phenylquinazolin-4-yl)amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 42809231) has the molecular formula C24H18ClF3N4O and a molecular weight of 470.88 g/mol. Its IUPAC name is N-[2-[(7-chloro-2-phenylquinazolin-4-yl)amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(7-chloro-2-phenylquinazolin-4-yl)amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42809231 |
| Molecular Formula | C24H18ClF3N4O |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | N-[2-[(7-chloro-2-phenylquinazolin-4-yl)amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNc1nc(-c2ccccc2)nc2cc(Cl)ccc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H18ClF3N4O/c25-18-10-11-19-20(14-18)31-21(15-4-2-1-3-5-15)32-22(19)29-12-13-30-23(33)16-6-8-17(9-7-16)24(26,27)28/h1-11,14H,12-13H2,(H,30,33)(H,29,31,32) |
| InChIKey | ASCSWQMNPOWNFT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|