C24H19ClF3N5O — CID 42809310
1-[2-[[2-(4-chlorophenyl)quinazolin-4-yl]amino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 42809310) has the molecular formula C24H19ClF3N5O and a molecular weight of 485.90 g/mol. Its IUPAC name is 1-[2-[[2-(4-chlorophenyl)quinazolin-4-yl]amino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[[2-(4-chlorophenyl)quinazolin-4-yl]amino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42809310 |
| Molecular Formula | C24H19ClF3N5O |
| Molecular Weight | 485.90 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 1-[2-[[2-(4-chlorophenyl)quinazolin-4-yl]amino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCNc1nc(-c2ccc(Cl)cc2)nc2ccccc12)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H19ClF3N5O/c25-17-9-5-15(6-10-17)21-32-20-4-2-1-3-19(20)22(33-21)29-13-14-30-23(34)31-18-11-7-16(8-12-18)24(26,27)28/h1-12H,13-14H2,(H,29,32,33)(H2,30,31,34) |
| InChIKey | HOLYYSYCOFDONH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.90 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|