C19H23N5OS — CID 42809298
1-tert-butyl-3-[2-[(2-thiophen-2-ylquinazolin-4-yl)amino]ethyl]urea (PubChem CID 42809298) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[(2-thiophen-2-ylquinazolin-4-yl)amino]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-[(2-thiophen-2-ylquinazolin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 42809298 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-tert-butyl-3-[2-[(2-thiophen-2-ylquinazolin-4-yl)amino]ethyl]urea |
| SMILES | CC(C)(C)NC(=O)NCCNc1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C19H23N5OS/c1-19(2,3)24-18(25)21-11-10-20-16-13-7-4-5-8-14(13)22-17(23-16)15-9-6-12-26-15/h4-9,12H,10-11H2,1-3H3,(H,20,22,23)(H2,21,24,25) |
| InChIKey | TZDRGUSWDOGQKZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|