C11H14F2N6 — CID 114073280
3,5-difluoro-6-hydrazinyl-N-(3-imidazol-1-ylpropyl)pyridin-2-amine (PubChem CID 114073280) has the molecular formula C11H14F2N6 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3,5-difluoro-6-hydrazinyl-N-(3-imidazol-1-ylpropyl)pyridin-2-amine.
| Compound Name | 3,5-difluoro-6-hydrazinyl-N-(3-imidazol-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114073280 |
| Molecular Formula | C11H14F2N6 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3,5-difluoro-6-hydrazinyl-N-(3-imidazol-1-ylpropyl)pyridin-2-amine |
| SMILES | NNc1nc(NCCCn2ccnc2)c(F)cc1F |
| InChI | InChI=1S/C11H14F2N6/c12-8-6-9(13)11(18-14)17-10(8)16-2-1-4-19-5-3-15-7-19/h3,5-7H,1-2,4,14H2,(H2,16,17,18) |
| InChIKey | KLMYAEUUWHTIDC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|