C9H15F2N5O2S — CID 106332450
N-[3-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]propyl]methanesulfonamide (PubChem CID 106332450) has the molecular formula C9H15F2N5O2S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-[3-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332450 |
| Molecular Formula | C9H15F2N5O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[3-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C9H15F2N5O2S/c1-19(17,18)14-4-2-3-13-8-6(10)5-7(11)9(15-8)16-12/h5,14H,2-4,12H2,1H3,(H2,13,15,16) |
| InChIKey | ATPFWBXTHLSKOI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|