C9H14F3N5O2S — CID 102720651
3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide (PubChem CID 102720651) has the molecular formula C9H14F3N5O2S and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 102720651 |
| Molecular Formula | C9H14F3N5O2S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-[[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1-sulfonamide |
| SMILES | NNc1cc(C(F)(F)F)cc(NCCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C9H14F3N5O2S/c10-9(11,12)6-4-7(16-8(5-6)17-13)15-2-1-3-20(14,18)19/h4-5H,1-3,13H2,(H2,14,18,19)(H2,15,16,17) |
| InChIKey | GDAYCBZDFSRYBU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|