C11H17F3N4O2S — CID 102720887
6-hydrazinyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720887) has the molecular formula C11H17F3N4O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720887 |
| Molecular Formula | C11H17F3N4O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6-hydrazinyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)(CNc1cc(C(F)(F)F)cc(NN)n1)S(C)(=O)=O |
| InChI | InChI=1S/C11H17F3N4O2S/c1-10(2,21(3,19)20)6-16-8-4-7(11(12,13)14)5-9(17-8)18-15/h4-5H,6,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | AQXDWCOESPEXFH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|