C9H13F3N4O2S — CID 102720503
6-hydrazinyl-N-(2-methylsulfonylethyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720503) has the molecular formula C9H13F3N4O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-methylsulfonylethyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-(2-methylsulfonylethyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720503 |
| Molecular Formula | C9H13F3N4O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 6-hydrazinyl-N-(2-methylsulfonylethyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CS(=O)(=O)CCNc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C9H13F3N4O2S/c1-19(17,18)3-2-14-7-4-6(9(10,11)12)5-8(15-7)16-13/h4-5H,2-3,13H2,1H3,(H2,14,15,16) |
| InChIKey | YOBDKNGNIXQMSW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|