C20H19N5 — CID 11438900
N-(3-imidazol-1-ylpropyl)-4-phenylphthalazin-1-amine (PubChem CID 11438900) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-phenylphthalazin-1-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-phenylphthalazin-1-amine |
|---|---|
| PubChem CID | 11438900 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-phenylphthalazin-1-amine |
| SMILES | c1ccc(-c2nnc(NCCCn3ccnc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H19N5/c1-2-7-16(8-3-1)19-17-9-4-5-10-18(17)20(24-23-19)22-11-6-13-25-14-12-21-15-25/h1-5,7-10,12,14-15H,6,11,13H2,(H,22,24) |
| InChIKey | QURLODDTDAJIIL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|