C15H17N5 — CID 43450147
8-N-(3-imidazol-1-ylpropyl)quinoline-5,8-diamine (PubChem CID 43450147) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 8-N-(3-imidazol-1-ylpropyl)quinoline-5,8-diamine.
| Compound Name | 8-N-(3-imidazol-1-ylpropyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 43450147 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 8-N-(3-imidazol-1-ylpropyl)quinoline-5,8-diamine |
| SMILES | Nc1ccc(NCCCn2ccnc2)c2ncccc12 |
| InChI | InChI=1S/C15H17N5/c16-13-4-5-14(15-12(13)3-1-6-19-15)18-7-2-9-20-10-8-17-11-20/h1,3-6,8,10-11,18H,2,7,9,16H2 |
| InChIKey | FLFZEAAKZVPLOB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|