C18H30N8O3 — CID 23787659
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3-imidazol-1-ylpropyl)-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine (PubChem CID 23787659) has the molecular formula C18H30N8O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3-imidazol-1-ylpropyl)-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3-imidazol-1-ylpropyl)-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23787659 |
| Molecular Formula | C18H30N8O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3-imidazol-1-ylpropyl)-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCOc1nc(NCCCn2ccnc2)nc(NCCOCCOCCN)n1 |
| InChI | InChI=1S/C18H30N8O3/c1-2-10-29-18-24-16(21-5-3-8-26-9-6-20-15-26)23-17(25-18)22-7-12-28-14-13-27-11-4-19/h2,6,9,15H,1,3-5,7-8,10-14,19H2,(H2,21,22,23,24,25) |
| InChIKey | AFRPNMRXUHLSGC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|