C15H28N6O3 — CID 23787663
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-propan-2-yloxy-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 23787663) has the molecular formula C15H28N6O3 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-propan-2-yloxy-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-propan-2-yloxy-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23787663 |
| Molecular Formula | C15H28N6O3 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-propan-2-yloxy-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCCOCCOCCN)nc(OC(C)C)n1 |
| InChI | InChI=1S/C15H28N6O3/c1-4-6-17-13-19-14(21-15(20-13)24-12(2)3)18-7-9-23-11-10-22-8-5-16/h4,12H,1,5-11,16H2,2-3H3,(H2,17,18,19,20,21) |
| InChIKey | YVMZSAWRWBLGAZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|