C30H41N9O2 — CID 23901017
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3,3-diphenylpropyl)-6-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 23901017) has the molecular formula C30H41N9O2 and a molecular weight of 559.72 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3,3-diphenylpropyl)-6-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3,3-diphenylpropyl)-6-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23901017 |
| Molecular Formula | C30H41N9O2 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(3,3-diphenylpropyl)-6-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCOCCOCCNc1nc(NCCCn2ccnc2)nc(NCCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C30H41N9O2/c31-13-20-40-22-23-41-21-17-35-30-37-28(33-14-7-18-39-19-16-32-24-39)36-29(38-30)34-15-12-27(25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-11,16,19,24,27H,7,12-15,17-18,20-23,31H2,(H3,33,34,35,36,37,38) |
| InChIKey | HOAAQKXRQZXCDQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|