C17H23N9O — CID 23844906
2-[[4-(3-imidazol-1-ylpropylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 23844906) has the molecular formula C17H23N9O and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[[4-(3-imidazol-1-ylpropylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(3-imidazol-1-ylpropylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 23844906 |
| Molecular Formula | C17H23N9O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-[[4-(3-imidazol-1-ylpropylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(NCCCn2ccnc2)nc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C17H23N9O/c27-11-8-21-16-23-15(20-6-3-9-26-10-7-18-13-26)24-17(25-16)22-12-14-4-1-2-5-19-14/h1-2,4-5,7,10,13,27H,3,6,8-9,11-12H2,(H3,20,21,22,23,24,25) |
| InChIKey | GAOYSYTZNVMUAE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|