C13H22N8 — CID 80757025
2-N,2-N-diethyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80757025) has the molecular formula C13H22N8 and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80757025 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-(3-imidazol-1-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)nc(NCCCn2ccnc2)n1 |
| InChI | InChI=1S/C13H22N8/c1-3-21(4-2)13-18-11(14)17-12(19-13)16-6-5-8-20-9-7-15-10-20/h7,9-10H,3-6,8H2,1-2H3,(H3,14,16,17,18,19) |
| InChIKey | OPHKRXHOFVTTJL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|