C12H17FN6 — CID 135106368
5-fluoro-2-N-(3-imidazol-1-ylpropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 135106368) has the molecular formula C12H17FN6 and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-fluoro-2-N-(3-imidazol-1-ylpropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-(3-imidazol-1-ylpropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135106368 |
| Molecular Formula | C12H17FN6 |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5-fluoro-2-N-(3-imidazol-1-ylpropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(NCCCn2ccnc2)ncc1F |
| InChI | InChI=1S/C12H17FN6/c1-18(2)11-10(13)8-16-12(17-11)15-4-3-6-19-7-5-14-9-19/h5,7-9H,3-4,6H2,1-2H3,(H,15,16,17) |
| InChIKey | DSWBVQDKYJPTRS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|