C24H32N8O4 — CID 23758435
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 23758435) has the molecular formula C24H32N8O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23758435 |
| Molecular Formula | C24H32N8O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-pyridin-2-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCOCCOCCNc1nc(NCCc2ccccn2)nc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C24H32N8O4/c25-7-11-33-13-14-34-12-10-28-23-30-22(27-9-6-19-3-1-2-8-26-19)31-24(32-23)29-16-18-4-5-20-21(15-18)36-17-35-20/h1-5,8,15H,6-7,9-14,16-17,25H2,(H3,27,28,29,30,31,32) |
| InChIKey | LMCIVEQKTXXNMG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|