C31H37N7O4 — CID 23984670
6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 23984670) has the molecular formula C31H37N7O4 and a molecular weight of 571.68 g/mol. Its IUPAC name is 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23984670 |
| Molecular Formula | C31H37N7O4 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCOCCOCCNc1nc(NCc2ccc3c(c2)OCO3)nc(N(Cc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C31H37N7O4/c32-13-15-39-17-18-40-16-14-33-29-35-30(34-20-26-11-12-27-28(19-26)42-23-41-27)37-31(36-29)38(21-24-7-3-1-4-8-24)22-25-9-5-2-6-10-25/h1-12,19H,13-18,20-23,32H2,(H2,33,34,35,36,37) |
| InChIKey | CUIXBQRSWHPQCJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|