C12H21ClN4O2 — CID 106116866
3-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]hexan-1-ol (PubChem CID 106116866) has the molecular formula C12H21ClN4O2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106116866 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nc(Cl)nc(OCC)n1 |
| InChI | InChI=1S/C12H21ClN4O2/c1-3-5-9(6-7-18)8-14-11-15-10(13)16-12(17-11)19-4-2/h9,18H,3-8H2,1-2H3,(H,14,15,16,17) |
| InChIKey | SXASSMCROKAKBP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |