C13H23N3O3 — CID 106115742
3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]hexan-1-ol (PubChem CID 106115742) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106115742 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H23N3O3/c1-4-5-10(6-7-17)9-14-13-15-11(18-2)8-12(16-13)19-3/h8,10,17H,4-7,9H2,1-3H3,(H,14,15,16) |
| InChIKey | WHGPJTGISOOJCS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |