C8H13ClN4O2 — CID 62857388
2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 62857388) has the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 62857388 |
| Molecular Formula | C8H13ClN4O2 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | CCOc1nc(Cl)nc(NC(C)CO)n1 |
| InChI | InChI=1S/C8H13ClN4O2/c1-3-15-8-12-6(9)11-7(13-8)10-5(2)4-14/h5,14H,3-4H2,1-2H3,(H,10,11,12,13) |
| InChIKey | GHPNDIMXSOJHTA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |