C12H14BrClN6O — CID 107617973
N-(4-bromo-3-chlorophenyl)-4-hydrazinyl-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 107617973) has the molecular formula C12H14BrClN6O and a molecular weight of 373.64 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-4-hydrazinyl-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(4-bromo-3-chlorophenyl)-4-hydrazinyl-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 107617973 |
| Molecular Formula | C12H14BrClN6O |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-4-hydrazinyl-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NN)nc(Nc2ccc(Br)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H14BrClN6O/c1-2-5-21-12-18-10(17-11(19-12)20-15)16-7-3-4-8(13)9(14)6-7/h3-4,6H,2,5,15H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | KLQYCLKIYAGGSC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|