C12H12FN3 — CID 154140072
4-N-(4-aminophenyl)-2-fluorobenzene-1,4-diamine (PubChem CID 154140072) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-2-fluorobenzene-1,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-2-fluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 154140072 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-N-(4-aminophenyl)-2-fluorobenzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(N)c(F)c2)cc1 |
| InChI | InChI=1S/C12H12FN3/c13-11-7-10(5-6-12(11)15)16-9-3-1-8(14)2-4-9/h1-7,16H,14-15H2 |
| InChIKey | HGCVCVWDZHOYKW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|