C27H20F2N4O4 — CID 171466103
1-N'-[3-fluoro-4-(4-hydroxy-3-pyrimidin-4-ylphenoxy)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 171466103) has the molecular formula C27H20F2N4O4 and a molecular weight of 502.48 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-(4-hydroxy-3-pyrimidin-4-ylphenoxy)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-(4-hydroxy-3-pyrimidin-4-ylphenoxy)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 171466103 |
| Molecular Formula | C27H20F2N4O4 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-N'-[3-fluoro-4-(4-hydroxy-3-pyrimidin-4-ylphenoxy)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(C(=O)Nc2ccc(Oc3ccc(O)c(-c4ccncn4)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H20F2N4O4/c28-16-1-3-17(4-2-16)32-25(35)27(10-11-27)26(36)33-18-5-8-24(21(29)13-18)37-19-6-7-23(34)20(14-19)22-9-12-30-15-31-22/h1-9,12-15,34H,10-11H2,(H,32,35)(H,33,36) |
| InChIKey | VWYUWLODPOIYRI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|