C22H17F3N4O3 — CID 68719274
1-N'-[3-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 68719274) has the molecular formula C22H17F3N4O3 and a molecular weight of 442.40 g/mol. Its IUPAC name is 1-N'-[3-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68719274 |
| Molecular Formula | C22H17F3N4O3 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-N'-[3-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Nc1cc(Oc2cc(F)cc(NC(=O)C3(C(=O)Nc4ccc(F)cc4)CC3)c2F)ccn1 |
| InChI | InChI=1S/C22H17F3N4O3/c23-12-1-3-14(4-2-12)28-20(30)22(6-7-22)21(31)29-16-9-13(24)10-17(19(16)25)32-15-5-8-27-18(26)11-15/h1-5,8-11H,6-7H2,(H2,26,27)(H,28,30)(H,29,31) |
| InChIKey | GKQAKZBGTHLEMN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|