C25H23FN4O3S — CID 118492479
1-N'-(4-fluorophenyl)-1-N-[4-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]thiazepin-9-yloxy)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 118492479) has the molecular formula C25H23FN4O3S and a molecular weight of 478.55 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]thiazepin-9-yloxy)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]thiazepin-9-yloxy)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 118492479 |
| Molecular Formula | C25H23FN4O3S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]thiazepin-9-yloxy)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(C(=O)Nc2ccc(Oc3ccnc4c3SCCCN4)cc2)CC1 |
| InChI | InChI=1S/C25H23FN4O3S/c26-16-2-4-17(5-3-16)29-23(31)25(11-12-25)24(32)30-18-6-8-19(9-7-18)33-20-10-14-28-22-21(20)34-15-1-13-27-22/h2-10,14H,1,11-13,15H2,(H,27,28)(H,29,31)(H,30,32) |
| InChIKey | FEJCAYGIXQVMAV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|