C24H22FN5O2 — CID 70931627
1-N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-4-ylamino)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 70931627) has the molecular formula C24H22FN5O2 and a molecular weight of 431.47 g/mol. Its IUPAC name is 1-N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-4-ylamino)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-4-ylamino)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 70931627 |
| Molecular Formula | C24H22FN5O2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-4-ylamino)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(C(=O)Nc2ccc(Nc3ccnc4c3CCN4)cc2)CC1 |
| InChI | InChI=1S/C24H22FN5O2/c25-15-1-3-17(4-2-15)29-22(31)24(11-12-24)23(32)30-18-7-5-16(6-8-18)28-20-10-14-27-21-19(20)9-13-26-21/h1-8,10,14H,9,11-13H2,(H,29,31)(H,30,32)(H2,26,27,28) |
| InChIKey | WPSPDLHZHPLYNW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|