C20H22N6S2 — CID 143557648
4-N-[4-amino-3-[5-[(Z)-1-methylsulfanylbut-1-enyl]thiophene-2-carboximidoyl]phenyl]pyrimidine-2,4-diamine (PubChem CID 143557648) has the molecular formula C20H22N6S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 4-N-[4-amino-3-[5-[(Z)-1-methylsulfanylbut-1-enyl]thiophene-2-carboximidoyl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-amino-3-[5-[(Z)-1-methylsulfanylbut-1-enyl]thiophene-2-carboximidoyl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143557648 |
| Molecular Formula | C20H22N6S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-N-[4-amino-3-[5-[(Z)-1-methylsulfanylbut-1-enyl]thiophene-2-carboximidoyl]phenyl]pyrimidine-2,4-diamine |
| SMILES | [H]/N=C(\c1ccc(/C(=C/CC)SC)s1)c1cc(Nc2ccnc(N)n2)ccc1N |
| InChI | InChI=1S/C20H22N6S2/c1-3-4-15(27-2)16-7-8-17(28-16)19(22)13-11-12(5-6-14(13)21)25-18-9-10-24-20(23)26-18/h4-11,22H,3,21H2,1-2H3,(H3,23,24,25,26)/b15-4-,22-19- |
| InChIKey | XHSQWMAJZGNCBL-MIIHWBFWSA-N |
| XLogP | 4.98 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|