C15H18N6O — CID 143557640
(E)-4-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-methanimidoylphenyl]but-3-en-1-ol (PubChem CID 143557640) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is (E)-4-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-methanimidoylphenyl]but-3-en-1-ol.
| Compound Name | (E)-4-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-methanimidoylphenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 143557640 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (E)-4-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-methanimidoylphenyl]but-3-en-1-ol |
| SMILES | [H]/N=C/c1cc(Nc2ccnc(N)n2)cc(/C=C/CCO)c1N |
| InChI | InChI=1S/C15H18N6O/c16-9-11-8-12(20-13-4-5-19-15(18)21-13)7-10(14(11)17)3-1-2-6-22/h1,3-5,7-9,16,22H,2,6,17H2,(H3,18,19,20,21)/b3-1+,16-9+ |
| InChIKey | NKAYZQXAFXNLJT-VWIMEHRESA-N |
| XLogP | 1.78 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|