C11H12N6 — CID 143557825
4-N-(3-amino-2-methanimidoylphenyl)pyrimidine-2,4-diamine (PubChem CID 143557825) has the molecular formula C11H12N6 and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-N-(3-amino-2-methanimidoylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-amino-2-methanimidoylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143557825 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-N-(3-amino-2-methanimidoylphenyl)pyrimidine-2,4-diamine |
| SMILES | [H]/N=C/c1c(N)cccc1Nc1ccnc(N)n1 |
| InChI | InChI=1S/C11H12N6/c12-6-7-8(13)2-1-3-9(7)16-10-4-5-15-11(14)17-10/h1-6,12H,13H2,(H3,14,15,16,17)/b12-6+ |
| InChIKey | TVPVDXMDRQLUSR-WUXMJOGZSA-N |
| XLogP | 1.38 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|