C16H19N7 — CID 143557614
4-N-[4-amino-3-[3-(dimethylamino)prop-1-ynyl]-5-methanimidoylphenyl]pyrimidine-2,4-diamine (PubChem CID 143557614) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is 4-N-[4-amino-3-[3-(dimethylamino)prop-1-ynyl]-5-methanimidoylphenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-amino-3-[3-(dimethylamino)prop-1-ynyl]-5-methanimidoylphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143557614 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 4-N-[4-amino-3-[3-(dimethylamino)prop-1-ynyl]-5-methanimidoylphenyl]pyrimidine-2,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ccnc(N)n2)cc(C#CCN(C)C)c1N |
| InChI | InChI=1S/C16H19N7/c1-23(2)7-3-4-11-8-13(9-12(10-17)15(11)18)21-14-5-6-20-16(19)22-14/h5-6,8-10,17H,7,18H2,1-2H3,(H3,19,20,21,22)/b17-10+ |
| InChIKey | YWOFXHWCIZMVSA-LICLKQGHSA-N |
| XLogP | 1.30 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|