C20H20N7O+ — CID 143557604
[2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-(5-methoxy-1H-indol-2-yl)phenyl]methylideneazanium (PubChem CID 143557604) has the molecular formula C20H20N7O+ and a molecular weight of 374.43 g/mol. Its IUPAC name is [2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-(5-methoxy-1H-indol-2-yl)phenyl]methylideneazanium.
| Compound Name | [2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-(5-methoxy-1H-indol-2-yl)phenyl]methylideneazanium |
|---|---|
| PubChem CID | 143557604 |
| Molecular Formula | C20H20N7O+ |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [2-amino-5-[(2-aminopyrimidin-4-yl)amino]-3-(5-methoxy-1H-indol-2-yl)phenyl]methylideneazanium |
| SMILES | COc1ccc2[nH]c(-c3cc(Nc4ccnc(N)n4)cc(C=[NH2+])c3N)cc2c1 |
| InChI | InChI=1S/C20H19N7O/c1-28-14-2-3-16-11(7-14)8-17(26-16)15-9-13(6-12(10-21)19(15)22)25-18-4-5-24-20(23)27-18/h2-10,21,26H,22H2,1H3,(H3,23,24,25,27)/p+1 |
| InChIKey | MMYJSEYPYCDIOU-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|