C18H17FN6 — CID 143557319
4-N-[4-amino-3-(4-fluoro-3-methylphenyl)-5-methanimidoylphenyl]pyrimidine-2,4-diamine (PubChem CID 143557319) has the molecular formula C18H17FN6 and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-N-[4-amino-3-(4-fluoro-3-methylphenyl)-5-methanimidoylphenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-amino-3-(4-fluoro-3-methylphenyl)-5-methanimidoylphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143557319 |
| Molecular Formula | C18H17FN6 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-N-[4-amino-3-(4-fluoro-3-methylphenyl)-5-methanimidoylphenyl]pyrimidine-2,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ccnc(N)n2)cc(-c2ccc(F)c(C)c2)c1N |
| InChI | InChI=1S/C18H17FN6/c1-10-6-11(2-3-15(10)19)14-8-13(7-12(9-20)17(14)21)24-16-4-5-23-18(22)25-16/h2-9,20H,21H2,1H3,(H3,22,23,24,25)/b20-9+ |
| InChIKey | CLHGNOCVARKZNS-AWQFTUOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|